CAS 1774-12-5 appears in our catalog under these names: 5-(4-(METHOXYPHENYL))-1,3-CYCLOHEXANEDI&, 5-(4-Methoxyphenyl)cyclohexane-dione, 98%, 5-(4-Methoxyphenyl)cyclohexane-1,3-dione, 98%, 5-(4-methoxyphenyl)cyclohexane-1,3-dione, 98%, 98%. Offered by: Sigma-Aldrich, Fluorochem, Combi-blocks, Ambeed, Chemat. Available pack sizes: 5G, 250mg, 1g, 10g, 100mg.
5-(4-methoxyphenyl)cyclohexane-1,3-dione (CAS 1774-12-5) is a chemical compound with the molecular formula C13H14O3 and a molecular weight of 218.25 g/mol. IUPAC name: 5-(4-methoxyphenyl)cyclohexane-1,3-dione. InChIKey: AHYCBDWPHFFKFK-UHFFFAOYSA-N.
| Molecular formula | C13H14O3 |
|---|---|
| Molecular weight | 218.25 g/mol |
| IUPAC name | 5-(4-methoxyphenyl)cyclohexane-1,3-dione |
| InChIKey | AHYCBDWPHFFKFK-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2CC(=O)CC(=O)C2 |
Computed by PubChem (NCBI)