CAS 27462-91-5 is the registry number for 5-(3-Methoxyphenyl)cyclohexane-1,3-dione, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 25g, 10g.
5-(3-methoxyphenyl)cyclohexane-1,3-dione (CAS 27462-91-5) is a chemical compound with the molecular formula C13H14O3 and a molecular weight of 218.25 g/mol. IUPAC name: 5-(3-methoxyphenyl)cyclohexane-1,3-dione. InChIKey: AQUXWSRUHWNKNU-UHFFFAOYSA-N.
| Molecular formula | C13H14O3 |
|---|---|
| Molecular weight | 218.25 g/mol |
| IUPAC name | 5-(3-methoxyphenyl)cyclohexane-1,3-dione |
| InChIKey | AQUXWSRUHWNKNU-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC(=C1)C2CC(=O)CC(=O)C2 |
Computed by PubChem (NCBI)