Products 7600-35-3
CAS 7600-35-3 is the registry number for N-(4-Bromophenyl)methacrylamide, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
N-(4-bromophenyl)-2-methylprop-2-enamide (CAS 7600-35-3) is a chemical compound with the molecular formula C10H10BrNO and a molecular weight of 240.10 g/mol. IUPAC name: N-(4-bromophenyl)-2-methylprop-2-enamide. InChIKey: SLCQGECCJKYUCZ-UHFFFAOYSA-N.
| Molecular formula | C10H10BrNO |
|---|---|
| Molecular weight | 240.10 g/mol |
| IUPAC name | N-(4-bromophenyl)-2-methylprop-2-enamide |
| InChIKey | SLCQGECCJKYUCZ-UHFFFAOYSA-N |
| SMILES | CC(=C)C(=O)NC1=CC=C(C=C1)Br |
Computed by PubChem (NCBI)