CAS 7606-34-0 is the registry number for 3-(4-Nitrophenyl)azetidine hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-(4-nitrophenyl)azetidine;hydrochloride (CAS 7606-34-0) is a chemical compound with the molecular formula C9H11ClN2O2 and a molecular weight of 214.65 g/mol. IUPAC name: 3-(4-nitrophenyl)azetidine;hydrochloride. InChIKey: CXVGZNSRXNPLDO-UHFFFAOYSA-N.
| Molecular formula | C9H11ClN2O2 |
|---|---|
| Molecular weight | 214.65 g/mol |
| IUPAC name | 3-(4-nitrophenyl)azetidine;hydrochloride |
| InChIKey | CXVGZNSRXNPLDO-UHFFFAOYSA-N |
| SMILES | C1C(CN1)C2=CC=C(C=C2)[N+](=O)[O-].Cl |
Computed by PubChem (NCBI)