CAS 76075-79-1 appears in our catalog under these names: 2-(4-Chlorophenoxy)-3-methylbutanoic acid, 95%, 2-(4-Chlorophenoxy)-3-methylbutanoic acid, 2-(4-Chlorophenoxy)-3-methylbutanoic acid 95%, 2-(4-Chlorophenoxy)-3-methylbutanoic acid, 95%, 95%, 2-(4-chlorophenoxy)-3-methylbutanoic acid, 98%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 500mg, 50mg, 100mg, 1000mg, 1g, 5g.
2-(4-chlorophenoxy)-3-methylbutanoic acid (CAS 76075-79-1) is a chemical compound with the molecular formula C11H13ClO3 and a molecular weight of 228.67 g/mol. IUPAC name: 2-(4-chlorophenoxy)-3-methylbutanoic acid. InChIKey: YIDWVTSSFOIVPL-UHFFFAOYSA-N.
| Molecular formula | C11H13ClO3 |
|---|---|
| Molecular weight | 228.67 g/mol |
| IUPAC name | 2-(4-chlorophenoxy)-3-methylbutanoic acid |
| InChIKey | YIDWVTSSFOIVPL-UHFFFAOYSA-N |
| SMILES | CC(C)C(C(=O)O)OC1=CC=C(C=C1)Cl |
Computed by PubChem (NCBI)