CAS 760910-22-3 appears in our catalog under these names: 5,7-Dimethoxybenzo(d)thiazol-2-amine, 98%, 5,7-Dimethoxy-1,3-benzothiazol-2-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
5,7-dimethoxy-1,3-benzothiazol-2-amine (CAS 760910-22-3) is a chemical compound with the molecular formula C9H10N2O2S and a molecular weight of 210.26 g/mol. IUPAC name: 5,7-dimethoxy-1,3-benzothiazol-2-amine. InChIKey: JRMYWSGFZFQJGS-UHFFFAOYSA-N.
| Molecular formula | C9H10N2O2S |
|---|---|
| Molecular weight | 210.26 g/mol |
| IUPAC name | 5,7-dimethoxy-1,3-benzothiazol-2-amine |
| InChIKey | JRMYWSGFZFQJGS-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C(=C1)OC)SC(=N2)N |
Computed by PubChem (NCBI)