CAS 760976-10-1 appears in our catalog under these names: 4-(3,5-Dimethylphenyl)benzaldehyde, 95%, 4-(3,5-Dimethylphenyl)benzaldehyde. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 25g, 1g, 250mg, 5g, 100mg.
4-(3,5-dimethylphenyl)benzaldehyde (CAS 760976-10-1) is a chemical compound with the molecular formula C15H14O and a molecular weight of 210.27 g/mol. IUPAC name: 4-(3,5-dimethylphenyl)benzaldehyde. InChIKey: DIEZRQJNMZQYGV-UHFFFAOYSA-N.
| Molecular formula | C15H14O |
|---|---|
| Molecular weight | 210.27 g/mol |
| IUPAC name | 4-(3,5-dimethylphenyl)benzaldehyde |
| InChIKey | DIEZRQJNMZQYGV-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)C2=CC=C(C=C2)C=O)C |
Computed by PubChem (NCBI)