CAS 76289-34-4 is the registry number for 3-Chloro-n-(6-methyl-1,3-benzothiazol-2-yl)propanamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
3-chloro-N-(6-methyl-1,3-benzothiazol-2-yl)propanamide (CAS 76289-34-4) is a chemical compound with the molecular formula C11H11ClN2OS and a molecular weight of 254.74 g/mol. IUPAC name: 3-chloro-N-(6-methyl-1,3-benzothiazol-2-yl)propanamide. InChIKey: QJZMKHLLJOADHG-UHFFFAOYSA-N.
| Molecular formula | C11H11ClN2OS |
|---|---|
| Molecular weight | 254.74 g/mol |
| IUPAC name | 3-chloro-N-(6-methyl-1,3-benzothiazol-2-yl)propanamide |
| InChIKey | QJZMKHLLJOADHG-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)N=C(S2)NC(=O)CCCl |
Computed by PubChem (NCBI)