CAS 89567-03-3 appears in our catalog under these names: 2-(Chloromethyl)-5,6,7,8-tetrahydro[1]benzothieno[2,3-d]pyrimidin-4(3h)-one, 95%, LM-1554. Offered by: Combi-blocks, MedChemExpress. Available pack sizes: 250mg, 1g, 100mg, Get quote.
2-(chloromethyl)-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one (CAS 89567-03-3) is a chemical compound with the molecular formula C11H11ClN2OS and a molecular weight of 254.74 g/mol. IUPAC name: 2-(chloromethyl)-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one. InChIKey: GDHMBNWVLWMONW-UHFFFAOYSA-N.
| Molecular formula | C11H11ClN2OS |
|---|---|
| Molecular weight | 254.74 g/mol |
| IUPAC name | 2-(chloromethyl)-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| InChIKey | GDHMBNWVLWMONW-UHFFFAOYSA-N |
| SMILES | C1CCC2=C(C1)C3=C(S2)N=C(NC3=O)CCl |
Computed by PubChem (NCBI)