Products 944890-81-7
CAS 944890-81-7 is the registry number for 2-Chloro-n-(6-methyl-1,3-benzothiazol-2-yl)propanamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-chloro-N-(6-methyl-1,3-benzothiazol-2-yl)propanamide (CAS 944890-81-7) is a chemical compound with the molecular formula C11H11ClN2OS and a molecular weight of 254.74 g/mol. IUPAC name: 2-chloro-N-(6-methyl-1,3-benzothiazol-2-yl)propanamide. InChIKey: HYLQWPDMMNYPNQ-UHFFFAOYSA-N.
| Molecular formula | C11H11ClN2OS |
|---|---|
| Molecular weight | 254.74 g/mol |
| IUPAC name | 2-chloro-N-(6-methyl-1,3-benzothiazol-2-yl)propanamide |
| InChIKey | HYLQWPDMMNYPNQ-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)N=C(S2)NC(=O)C(C)Cl |
Computed by PubChem (NCBI)