CAS 76322-24-2 appears in our catalog under these names: 7-Methoxychroman-3-one, 95%, 7-Methoxy-3,4-dihydro-2H-1-benzopyran-3-one. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 50mg, 0,5g.
7-methoxy-4H-chromen-3-one (CAS 76322-24-2) is a chemical compound with the molecular formula C10H10O3 and a molecular weight of 178.18 g/mol. IUPAC name: 7-methoxy-4H-chromen-3-one. InChIKey: FZNSDPYTCOXWSZ-UHFFFAOYSA-N.
| Molecular formula | C10H10O3 |
|---|---|
| Molecular weight | 178.18 g/mol |
| IUPAC name | 7-methoxy-4H-chromen-3-one |
| InChIKey | FZNSDPYTCOXWSZ-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(CC(=O)CO2)C=C1 |
Computed by PubChem (NCBI)