Products 76435-22-8
CAS 76435-22-8 appears in our catalog under these names: 5-Bromo-1,3-dimethyl-2-nitrobenzene 95+%, 5-Bromo-1,3-dimethyl-2-nitrobenzene, 95+%, 95+%. Offered by: Ambeed, Chemat. Available pack sizes: 1g.
5-bromo-1,3-dimethyl-2-nitrobenzene (CAS 76435-22-8) is a chemical compound with the molecular formula C8H8BrNO2 and a molecular weight of 230.06 g/mol. IUPAC name: 5-bromo-1,3-dimethyl-2-nitrobenzene. InChIKey: RBBIBDKTQQOFAG-UHFFFAOYSA-N.
| Molecular formula | C8H8BrNO2 |
|---|---|
| Molecular weight | 230.06 g/mol |
| IUPAC name | 5-bromo-1,3-dimethyl-2-nitrobenzene |
| InChIKey | RBBIBDKTQQOFAG-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1[N+](=O)[O-])C)Br |
Computed by PubChem (NCBI)