Products 764661-22-5
CAS 764661-22-5 is the registry number for (R,S)-1-Methyl-3-nicotinoylpyrrolidone-d4. Offered by: TRC. Available pack sizes: 100mg, 10mg.
1-methyl-3-(2,4,5,6-tetradeuteriopyridine-3-carbonyl)pyrrolidin-2-one (CAS 764661-22-5) is a chemical compound with the molecular formula C11H12N2O2 and a molecular weight of 208.25 g/mol. IUPAC name: 1-methyl-3-(2,4,5,6-tetradeuteriopyridine-3-carbonyl)pyrrolidin-2-one. InChIKey: SCVLPUZALILIEN-IKMBEDGYSA-N.
| Molecular formula | C11H12N2O2 |
|---|---|
| Molecular weight | 208.25 g/mol |
| IUPAC name | 1-methyl-3-(2,4,5,6-tetradeuteriopyridine-3-carbonyl)pyrrolidin-2-one |
| InChIKey | SCVLPUZALILIEN-IKMBEDGYSA-N |
| SMILES | [2H]C1=C(C(=C(N=C1[2H])[2H])C(=O)C2CCN(C2=O)C)[2H] |
Computed by PubChem (NCBI)