Products 764722-92-1

CAS 764722-92-1 is the registry number for 5-(4-Methoxy-2-methylphenyl)thiophene-2-carboxylic acid, 96%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

5-(4-methoxy-2-methylphenyl)thiophene-2-carboxylic acid (CAS 764722-92-1) is a chemical compound with the molecular formula C13H12O3S and a molecular weight of 248.30 g/mol. IUPAC name: 5-(4-methoxy-2-methylphenyl)thiophene-2-carboxylic acid. InChIKey: FAVOJKUFLBVYGT-UHFFFAOYSA-N.

Identity
Molecular formulaC13H12O3S
Molecular weight248.30 g/mol
IUPAC name5-(4-methoxy-2-methylphenyl)thiophene-2-carboxylic acid
InChIKeyFAVOJKUFLBVYGT-UHFFFAOYSA-N
SMILESCC1=C(C=CC(=C1)OC)C2=CC=C(S2)C(=O)O

Computed by PubChem (NCBI)