Products 915923-20-5

CAS 915923-20-5 is the registry number for 5-([(4-Methylphenyl)thio]methyl)-2-furoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg.

Structural formula: {0} (CAS {1})

5-[(4-methylphenyl)sulfanylmethyl]furan-2-carboxylic acid (CAS 915923-20-5) is a chemical compound with the molecular formula C13H12O3S and a molecular weight of 248.30 g/mol. IUPAC name: 5-[(4-methylphenyl)sulfanylmethyl]furan-2-carboxylic acid. InChIKey: YVVQCTVUNAOQNE-UHFFFAOYSA-N.

Identity
Molecular formulaC13H12O3S
Molecular weight248.30 g/mol
IUPAC name5-[(4-methylphenyl)sulfanylmethyl]furan-2-carboxylic acid
InChIKeyYVVQCTVUNAOQNE-UHFFFAOYSA-N
SMILESCC1=CC=C(C=C1)SCC2=CC=C(O2)C(=O)O

Computed by PubChem (NCBI)