CAS 893737-42-3 appears in our catalog under these names: 3-(4-Methylsulfonylphenyl)phenol, 98%, 4'-(Methylsulfonyl)-(1,1'-biphenyl)-3-ol, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
3-(4-methylsulfonylphenyl)phenol (CAS 893737-42-3) is a chemical compound with the molecular formula C13H12O3S and a molecular weight of 248.30 g/mol. IUPAC name: 3-(4-methylsulfonylphenyl)phenol. InChIKey: MMGUTUQZASAGLF-UHFFFAOYSA-N.
| Molecular formula | C13H12O3S |
|---|---|
| Molecular weight | 248.30 g/mol |
| IUPAC name | 3-(4-methylsulfonylphenyl)phenol |
| InChIKey | MMGUTUQZASAGLF-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC=C(C=C1)C2=CC(=CC=C2)O |
Computed by PubChem (NCBI)