CAS 76541-91-8 appears in our catalog under these names: 7-Amino-4-hydroxy-1,8-naphthyridin-2(1H)-one, 95+%, 7-Amino-1,8-naphthyridine-2,4-diol. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
7-amino-4-hydroxy-1H-1,8-naphthyridin-2-one (CAS 76541-91-8) is a chemical compound with the molecular formula C8H7N3O2 and a molecular weight of 177.16 g/mol. IUPAC name: 7-amino-4-hydroxy-1H-1,8-naphthyridin-2-one. InChIKey: YKWBJEGNZIUWLI-UHFFFAOYSA-N.
| Molecular formula | C8H7N3O2 |
|---|---|
| Molecular weight | 177.16 g/mol |
| IUPAC name | 7-amino-4-hydroxy-1H-1,8-naphthyridin-2-one |
| InChIKey | YKWBJEGNZIUWLI-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC2=C1C(=CC(=O)N2)O)N |
Computed by PubChem (NCBI)