CAS 76543-27-6 appears in our catalog under these names: N-Tosyl-3-azetidinone, 95-<97%, N-Tosyl-3-azetidinone, ≥97-<99%, 1-Tosylazetidin-3-one 98%, 1-Tosylazetidin-3-one, 98%, 98%, 1-[(4-methylphenyl)sulfonyl]-3-azetidinone, 95%. Offered by: Hoffman Fine Chemicals, Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 50g, 100g, 200g, 300g, 400g, 100mg, 250mg.
1-(4-methylphenyl)sulfonylazetidin-3-one (CAS 76543-27-6) is a chemical compound with the molecular formula C10H11NO3S and a molecular weight of 225.27 g/mol. IUPAC name: 1-(4-methylphenyl)sulfonylazetidin-3-one. InChIKey: YRVBXEVVGIQJOZ-UHFFFAOYSA-N.
| Molecular formula | C10H11NO3S |
|---|---|
| Molecular weight | 225.27 g/mol |
| IUPAC name | 1-(4-methylphenyl)sulfonylazetidin-3-one |
| InChIKey | YRVBXEVVGIQJOZ-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N2CC(=O)C2 |
Computed by PubChem (NCBI)