CAS 765911-39-5 is the registry number for 2,2'-Diethynyl-1,1'-binaphthalene, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
2-ethynyl-1-(2-ethynylnaphthalen-1-yl)naphthalene (CAS 765911-39-5) is a chemical compound with the molecular formula C24H14 and a molecular weight of 302.4 g/mol. IUPAC name: 2-ethynyl-1-(2-ethynylnaphthalen-1-yl)naphthalene. InChIKey: HOIXLTOIPZAMTP-UHFFFAOYSA-N.
| Molecular formula | C24H14 |
|---|---|
| Molecular weight | 302.4 g/mol |
| IUPAC name | 2-ethynyl-1-(2-ethynylnaphthalen-1-yl)naphthalene |
| InChIKey | HOIXLTOIPZAMTP-UHFFFAOYSA-N |
| SMILES | C#CC1=C(C2=CC=CC=C2C=C1)C3=C(C=CC4=CC=CC=C43)C#C |
Computed by PubChem (NCBI)