Products 205-83-4
CAS 205-83-4 appears in our catalog under these names: Naphtho[2,3-j]fluoranthene, 98%, Acenaphth(1,2-a)anthracene. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg.
Hexacyclo[14.7.1.02,15.03,12.05,10.020,24]tetracosa-1(23),2(15),3,5,7,9,11,13,16,18,20(24),21-dodecaene (CAS 205-83-4) is a chemical compound with the molecular formula C24H14 and a molecular weight of 302.4 g/mol. IUPAC name: hexacyclo[14.7.1.02,15.03,12.05,10.020,24]tetracosa-1(23),2(15),3,5,7,9,11,13,16,18,20(24),21-dodecaene. InChIKey: ZQYVVUIWXIUAKD-UHFFFAOYSA-N.
| Molecular formula | C24H14 |
|---|---|
| Molecular weight | 302.4 g/mol |
| IUPAC name | hexacyclo[14.7.1.02,15.03,12.05,10.020,24]tetracosa-1(23),2(15),3,5,7,9,11,13,16,18,20(24),21-dodecaene |
| InChIKey | ZQYVVUIWXIUAKD-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C3C(=CC2=C1)C=CC4=C3C5=CC=CC6=C5C4=CC=C6 |
Computed by PubChem (NCBI)