CAS 207-18-1 is the registry number for Naphtho[2,3-k]fluoranthene, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Hexacyclo[14.7.1.02,15.04,13.06,11.020,24]tetracosa-1(23),2,4,6,8,10,12,14,16,18,20(24),21-dodecaene (CAS 207-18-1) is a chemical compound with the molecular formula C24H14 and a molecular weight of 302.4 g/mol. IUPAC name: hexacyclo[14.7.1.02,15.04,13.06,11.020,24]tetracosa-1(23),2,4,6,8,10,12,14,16,18,20(24),21-dodecaene. InChIKey: UFZAKNUHTLXSMY-UHFFFAOYSA-N.
| Molecular formula | C24H14 |
|---|---|
| Molecular weight | 302.4 g/mol |
| IUPAC name | hexacyclo[14.7.1.02,15.04,13.06,11.020,24]tetracosa-1(23),2,4,6,8,10,12,14,16,18,20(24),21-dodecaene |
| InChIKey | UFZAKNUHTLXSMY-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C3C=C4C5=CC=CC6=C5C(=CC=C6)C4=CC3=CC2=C1 |
Computed by PubChem (NCBI)