CAS 97729-49-2 is the registry number for N-Acetyl-S-(3-chloro-2-hydroxypropyl)-L-cysteine. Offered by: TRC. Available pack sizes: 250mg.
(2R)-2-acetamido-3-(3-chloro-2-hydroxypropyl)sulfanylpropanoic acid (CAS 97729-49-2) is a chemical compound with the molecular formula C8H14ClNO4S and a molecular weight of 255.72 g/mol. IUPAC name: (2R)-2-acetamido-3-(3-chloro-2-hydroxypropyl)sulfanylpropanoic acid. InChIKey: AVEOXQDYMIQASN-MLWJPKLSSA-N.
| Molecular formula | C8H14ClNO4S |
|---|---|
| Molecular weight | 255.72 g/mol |
| IUPAC name | (2R)-2-acetamido-3-(3-chloro-2-hydroxypropyl)sulfanylpropanoic acid |
| InChIKey | AVEOXQDYMIQASN-MLWJPKLSSA-N |
| SMILES | CC(=O)N[C@@H](CSCC(CCl)O)C(=O)O |
Computed by PubChem (NCBI)