CAS 76631-46-4 appears in our catalog under these names: Medetomidine Impurity 26, Detomidine, >95% (HPLC), Detomidine. Offered by: Hubei YoungXin, TRC, TargetMol, GLPBio, MedChemExpress. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 1g, 5mg.
5-[(2,3-dimethylphenyl)methyl]-1H-imidazole (CAS 76631-46-4) is a chemical compound with the molecular formula C12H14N2 and a molecular weight of 186.25 g/mol. IUPAC name: 5-[(2,3-dimethylphenyl)methyl]-1H-imidazole. InChIKey: RHDJRPPFURBGLQ-UHFFFAOYSA-N.
| Molecular formula | C12H14N2 |
|---|---|
| Molecular weight | 186.25 g/mol |
| IUPAC name | 5-[(2,3-dimethylphenyl)methyl]-1H-imidazole |
| InChIKey | RHDJRPPFURBGLQ-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)CC2=CN=CN2)C |
Computed by PubChem (NCBI)