Products 76704-24-0

CAS 76704-24-0 is the registry number for Edoxaban Impurity 93. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

(1S,3S,6R)-7-oxabicyclo[4.1.0]heptane-3-carboxylic acid (CAS 76704-24-0) is a chemical compound with the molecular formula C7H10O3 and a molecular weight of 142.15 g/mol. IUPAC name: (1S,3S,6R)-7-oxabicyclo[4.1.0]heptane-3-carboxylic acid. InChIKey: OXQXGKNECHBVMO-JKUQZMGJSA-N.

Identity
Molecular formulaC7H10O3
Molecular weight142.15 g/mol
IUPAC name(1S,3S,6R)-7-oxabicyclo[4.1.0]heptane-3-carboxylic acid
InChIKeyOXQXGKNECHBVMO-JKUQZMGJSA-N
SMILESC1C[C@@H]2[C@@H](O2)C[C@H]1C(=O)O

Computed by PubChem (NCBI)