CAS 7677-48-7 is the registry number for 3-(Ethylamino)benzo[d]isothiazole 1,1-dioxide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
N-ethyl-1,1-dioxo-1,2-benzothiazol-3-imine (CAS 7677-48-7) is a chemical compound with the molecular formula C9H10N2O2S and a molecular weight of 210.26 g/mol. IUPAC name: N-ethyl-1,1-dioxo-1,2-benzothiazol-3-imine. InChIKey: PZZUBRHSSOQJRM-UHFFFAOYSA-N.
| Molecular formula | C9H10N2O2S |
|---|---|
| Molecular weight | 210.26 g/mol |
| IUPAC name | N-ethyl-1,1-dioxo-1,2-benzothiazol-3-imine |
| InChIKey | PZZUBRHSSOQJRM-UHFFFAOYSA-N |
| SMILES | CCN=C1C2=CC=CC=C2S(=O)(=O)N1 |
Computed by PubChem (NCBI)