CAS 768-36-5 is the registry number for Pyrazinamide Impurity 3. Offered by: Chemat Brand. Available pack sizes: on request.
4-oxidopyrazin-4-ium-2-carboxamide (CAS 768-36-5) is a chemical compound with the molecular formula C5H5N3O2 and a molecular weight of 139.11 g/mol. IUPAC name: 4-oxidopyrazin-4-ium-2-carboxamide. InChIKey: WWQPCELPPKZBJE-UHFFFAOYSA-N.
| Molecular formula | C5H5N3O2 |
|---|---|
| Molecular weight | 139.11 g/mol |
| IUPAC name | 4-oxidopyrazin-4-ium-2-carboxamide |
| InChIKey | WWQPCELPPKZBJE-UHFFFAOYSA-N |
| SMILES | C1=C[N+](=CC(=N1)C(=O)N)[O-] |
Computed by PubChem (NCBI)