CAS 7680-68-4 is the registry number for 1-Methyl Isonicotinamide Chloride. Offered by: TRC. Available pack sizes: 1g.
1-methylpyridin-1-ium-4-carboxamide chloride (CAS 7680-68-4) is a chemical compound with the molecular formula C7H9ClN2O and a molecular weight of 172.61 g/mol. IUPAC name: 1-methylpyridin-1-ium-4-carboxamide chloride. InChIKey: NCSYUVDQJSKXQH-UHFFFAOYSA-N.
| Molecular formula | C7H9ClN2O |
|---|---|
| Molecular weight | 172.61 g/mol |
| IUPAC name | 1-methylpyridin-1-ium-4-carboxamide chloride |
| InChIKey | NCSYUVDQJSKXQH-UHFFFAOYSA-N |
| SMILES | C[N+]1=CC=C(C=C1)C(=O)N.[Cl-] |
Computed by PubChem (NCBI)