Products 76872-28-1
CAS 76872-28-1 is the registry number for 10,12-dichloro-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraene, >95%, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
10,12-dichloro-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraene (CAS 76872-28-1) is a chemical compound with the molecular formula C9H6Cl2N2S and a molecular weight of 245.13 g/mol. IUPAC name: 10,12-dichloro-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraene. InChIKey: ALKRFXWBPRXDHO-UHFFFAOYSA-N.
| Molecular formula | C9H6Cl2N2S |
|---|---|
| Molecular weight | 245.13 g/mol |
| IUPAC name | 10,12-dichloro-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraene |
| InChIKey | ALKRFXWBPRXDHO-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C1)SC3=C2C(=NC(=N3)Cl)Cl |
Computed by PubChem (NCBI)