CAS 90418-16-9 appears in our catalog under these names: 5-Chloro-3-[(4-chlorophenyl)methyl]-1,2,4-thiadiazole, 95%, 5-Chloro-3-(4-chlorobenzyl)-1,2,4-thiadiazole, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 100mg, 1g.
5-chloro-3-[(4-chlorophenyl)methyl]-1,2,4-thiadiazole (CAS 90418-16-9) is a chemical compound with the molecular formula C9H6Cl2N2S and a molecular weight of 245.13 g/mol. IUPAC name: 5-chloro-3-[(4-chlorophenyl)methyl]-1,2,4-thiadiazole. InChIKey: ZTHYORRNWREZMC-UHFFFAOYSA-N.
| Molecular formula | C9H6Cl2N2S |
|---|---|
| Molecular weight | 245.13 g/mol |
| IUPAC name | 5-chloro-3-[(4-chlorophenyl)methyl]-1,2,4-thiadiazole |
| InChIKey | ZTHYORRNWREZMC-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CC2=NSC(=N2)Cl)Cl |
Computed by PubChem (NCBI)