CAS 93209-97-3 appears in our catalog under these names: 4-(2,4-Dichlorophenyl)-1,3-thiazol-2-amine, 96%, 4-(2,4-Dichlorophenyl)-1,3-thiazol-2-amine, 4-(2,4-Dichloro-phenyl)-thiazol-2-ylamine, 97%. Offered by: Combi-blocks, Biosynth, Fluorochem. Available pack sizes: 10g, 5g, 25g, 1g, 2000mg, 5000mg.
4-(2,4-dichlorophenyl)-1,3-thiazol-2-amine (CAS 93209-97-3) is a chemical compound with the molecular formula C9H6Cl2N2S and a molecular weight of 245.13 g/mol. IUPAC name: 4-(2,4-dichlorophenyl)-1,3-thiazol-2-amine. InChIKey: APJACVDBTHESJL-UHFFFAOYSA-N.
| Molecular formula | C9H6Cl2N2S |
|---|---|
| Molecular weight | 245.13 g/mol |
| IUPAC name | 4-(2,4-dichlorophenyl)-1,3-thiazol-2-amine |
| InChIKey | APJACVDBTHESJL-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Cl)C2=CSC(=N2)N |
Computed by PubChem (NCBI)