CAS 76953-97-4 is the registry number for 1,1,1-trifluoro-2-(p-tolyl)propan-2-ol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1,1,1-trifluoro-2-(4-methylphenyl)propan-2-ol (CAS 76953-97-4) is a chemical compound with the molecular formula C10H11F3O and a molecular weight of 204.19 g/mol. IUPAC name: 1,1,1-trifluoro-2-(4-methylphenyl)propan-2-ol. InChIKey: GJVUMLPRUOMETM-UHFFFAOYSA-N.
| Molecular formula | C10H11F3O |
|---|---|
| Molecular weight | 204.19 g/mol |
| IUPAC name | 1,1,1-trifluoro-2-(4-methylphenyl)propan-2-ol |
| InChIKey | GJVUMLPRUOMETM-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C(C)(C(F)(F)F)O |
Computed by PubChem (NCBI)