Products 771580-10-0
CAS 771580-10-0 is the registry number for 2-Fluoro-5-(trifluoromethyl)phenylethylamine. Offered by: Biosynth. Available pack sizes: 100mg, 250mg, 500mg.
2-[2-fluoro-5-(trifluoromethyl)phenyl]ethanamine (CAS 771580-10-0) is a chemical compound with the molecular formula C9H9F4N and a molecular weight of 207.17 g/mol. IUPAC name: 2-[2-fluoro-5-(trifluoromethyl)phenyl]ethanamine. InChIKey: OWVJINCYEZPRBD-UHFFFAOYSA-N.
| Molecular formula | C9H9F4N |
|---|---|
| Molecular weight | 207.17 g/mol |
| IUPAC name | 2-[2-fluoro-5-(trifluoromethyl)phenyl]ethanamine |
| InChIKey | OWVJINCYEZPRBD-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)CCN)F |
Computed by PubChem (NCBI)