Products 77165-99-2

CAS 77165-99-2 is the registry number for 2-((4,6-Dimethylpyrimidin-2-yl)oxy)ethyl acetate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg.

Structural formula: {0} (CAS {1})

Ethyl 2-(4,6-dimethylpyrimidin-2-yl)oxyacetate (CAS 77165-99-2) is a chemical compound with the molecular formula C10H14N2O3 and a molecular weight of 210.23 g/mol. IUPAC name: ethyl 2-(4,6-dimethylpyrimidin-2-yl)oxyacetate. InChIKey: ZTTSWTYNJNLSDI-UHFFFAOYSA-N.

Identity
Molecular formulaC10H14N2O3
Molecular weight210.23 g/mol
IUPAC nameethyl 2-(4,6-dimethylpyrimidin-2-yl)oxyacetate
InChIKeyZTTSWTYNJNLSDI-UHFFFAOYSA-N
SMILESCCOC(=O)COC1=NC(=CC(=N1)C)C

Computed by PubChem (NCBI)