Products 77180-19-9
CAS 77180-19-9 is the registry number for Cathepsin C-IN-7. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-amino-N-[(2S)-4-diazo-3-oxo-1-phenylbutan-2-yl]acetamide (CAS 77180-19-9) is a chemical compound with the molecular formula C12H14N4O2 and a molecular weight of 246.27 g/mol. IUPAC name: 2-amino-N-[(2S)-4-diazo-3-oxo-1-phenylbutan-2-yl]acetamide. InChIKey: CBOIZHHBFFTMCQ-JTQLQIEISA-N.
| Molecular formula | C12H14N4O2 |
|---|---|
| Molecular weight | 246.27 g/mol |
| IUPAC name | 2-amino-N-[(2S)-4-diazo-3-oxo-1-phenylbutan-2-yl]acetamide |
| InChIKey | CBOIZHHBFFTMCQ-JTQLQIEISA-N |
| SMILES | C1=CC=C(C=C1)C[C@@H](C(=O)C=[N+]=[N-])NC(=O)CN |
Computed by PubChem (NCBI)