CAS 772-33-8 appears in our catalog under these names: 2-Hydroxy-5-nitrobenzyl bromide, 95%, 2-Hydroxy-5-nitrobenzyl Bromide, >95.0%(T)(HPLC), alpha-Bromo-4-nitro-o-cresol, 95%, 2-HYDROXY-5-NITROBENZYL BROMIDE, 90%, 2-Hydroxy-5-nitrobenzyl bromide, >=95%. Offered by: Combi-blocks, TCI, Thermo Scientific (Acros), Sigma-Aldrich, Fluorochem. Available pack sizes: 5g, 1g, 25g.
2-(bromomethyl)-4-nitrophenol (CAS 772-33-8) is a chemical compound with the molecular formula C7H6BrNO3 and a molecular weight of 232.03 g/mol. IUPAC name: 2-(bromomethyl)-4-nitrophenol. InChIKey: KFDPCYZHENQOBV-UHFFFAOYSA-N.
| Molecular formula | C7H6BrNO3 |
|---|---|
| Molecular weight | 232.03 g/mol |
| IUPAC name | 2-(bromomethyl)-4-nitrophenol |
| InChIKey | KFDPCYZHENQOBV-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])CBr)O |
Computed by PubChem (NCBI)