CAS 77242-30-9 appears in our catalog under these names: 2-Amino-5-nitrobenzyl alcohol, 2-Amino-5-nitrobenzyl alcohol 97%, (2-Amino-5-nitrophenyl)methanol, 98%. Offered by: Biosynth, Ambeed, Fluorochem. Available pack sizes: 5g, 100mg, 250mg, 1g, 25g.
(2-amino-5-nitrophenyl)methanol (CAS 77242-30-9) is a chemical compound with the molecular formula C7H8N2O3 and a molecular weight of 168.15 g/mol. IUPAC name: (2-amino-5-nitrophenyl)methanol. InChIKey: XEALBFKUNCXFTO-UHFFFAOYSA-N.
| Molecular formula | C7H8N2O3 |
|---|---|
| Molecular weight | 168.15 g/mol |
| IUPAC name | (2-amino-5-nitrophenyl)methanol |
| InChIKey | XEALBFKUNCXFTO-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])CO)N |
Computed by PubChem (NCBI)