CAS 77256-78-1 is the registry number for 1,5-Diisopropyl-2,4-dinitrobenzene, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
1,5-dinitro-2,4-di(propan-2-yl)benzene (CAS 77256-78-1) is a chemical compound with the molecular formula C12H16N2O4 and a molecular weight of 252.27 g/mol. IUPAC name: 1,5-dinitro-2,4-di(propan-2-yl)benzene. InChIKey: SYRVNCAMWDHLKB-UHFFFAOYSA-N.
| Molecular formula | C12H16N2O4 |
|---|---|
| Molecular weight | 252.27 g/mol |
| IUPAC name | 1,5-dinitro-2,4-di(propan-2-yl)benzene |
| InChIKey | SYRVNCAMWDHLKB-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC(=C(C=C1[N+](=O)[O-])[N+](=O)[O-])C(C)C |
Computed by PubChem (NCBI)