Products 77265-43-1
CAS 77265-43-1 appears in our catalog under these names: Ethylene-Beta-ionol-d3, Ethylene-b-ionol-d3. Offered by: TRC, MedChemExpress. Available pack sizes: 100mg, 10mg, 100 mg, 10 mg.
(1E)-3-(trideuteriomethyl)-1-(2,6,6-trimethylcyclohexen-1-yl)penta-1,4-dien-3-ol (CAS 77265-43-1) is a chemical compound with the molecular formula C15H24O and a molecular weight of 223.37 g/mol. IUPAC name: (1E)-3-(trideuteriomethyl)-1-(2,6,6-trimethylcyclohexen-1-yl)penta-1,4-dien-3-ol. InChIKey: PZGYHDPZANRCSM-KVUBHPTHSA-N.
| Molecular formula | C15H24O |
|---|---|
| Molecular weight | 223.37 g/mol |
| IUPAC name | (1E)-3-(trideuteriomethyl)-1-(2,6,6-trimethylcyclohexen-1-yl)penta-1,4-dien-3-ol |
| InChIKey | PZGYHDPZANRCSM-KVUBHPTHSA-N |
| SMILES | [2H]C([2H])([2H])C(C=C)(/C=C/C1=C(CCCC1(C)C)C)O |
Computed by PubChem (NCBI)