CAS 773100-20-2 appears in our catalog under these names: 2-Chloro-4-methylquinoline-3-carboxylic acid, 2-Chloro-4-methylquinoline-3-carboxylic acid, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 50mg, 0,5g, 1g.
2-chloro-4-methylquinoline-3-carboxylic acid (CAS 773100-20-2) is a chemical compound with the molecular formula C11H8ClNO2 and a molecular weight of 221.64 g/mol. IUPAC name: 2-chloro-4-methylquinoline-3-carboxylic acid. InChIKey: SRVUMNXHIVGNGA-UHFFFAOYSA-N.
| Molecular formula | C11H8ClNO2 |
|---|---|
| Molecular weight | 221.64 g/mol |
| IUPAC name | 2-chloro-4-methylquinoline-3-carboxylic acid |
| InChIKey | SRVUMNXHIVGNGA-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NC2=CC=CC=C12)Cl)C(=O)O |
Computed by PubChem (NCBI)