CAS 773101-97-6 appears in our catalog under these names: 3-(1,3-Dioxolan-2-yl)benzoic acid, 95%, 3-(1,3-Dioxolan-2-yl)benzoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
3-(1,3-dioxolan-2-yl)benzoic acid (CAS 773101-97-6) is a chemical compound with the molecular formula C10H10O4 and a molecular weight of 194.18 g/mol. IUPAC name: 3-(1,3-dioxolan-2-yl)benzoic acid. InChIKey: CKOQSKSHQSFICH-UHFFFAOYSA-N.
| Molecular formula | C10H10O4 |
|---|---|
| Molecular weight | 194.18 g/mol |
| IUPAC name | 3-(1,3-dioxolan-2-yl)benzoic acid |
| InChIKey | CKOQSKSHQSFICH-UHFFFAOYSA-N |
| SMILES | C1COC(O1)C2=CC(=CC=C2)C(=O)O |
Computed by PubChem (NCBI)