Products 77331-76-1
CAS 77331-76-1 appears in our catalog under these names: (+)-Hyuganin D, Hyuganin D, Hyuganin D, ≥98%. Offered by: Biosynth, MedChemExpress, Chemat. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 5 mg, 1 mg.
[(9R,10R)-9-acetyloxy-8,8-dimethyl-2-oxo-9,10-dihydropyrano[2,3-f]chromen-10-yl] 2-methylpropanoate (CAS 77331-76-1) is a chemical compound with the molecular formula C20H22O7 and a molecular weight of 374.4 g/mol. IUPAC name: [(9R,10R)-9-acetyloxy-8,8-dimethyl-2-oxo-9,10-dihydropyrano[2,3-f]chromen-10-yl] 2-methylpropanoate. InChIKey: BUTUNJHEBGRWGK-QZTJIDSGSA-N.
| Molecular formula | C20H22O7 |
|---|---|
| Molecular weight | 374.4 g/mol |
| IUPAC name | [(9R,10R)-9-acetyloxy-8,8-dimethyl-2-oxo-9,10-dihydropyrano[2,3-f]chromen-10-yl] 2-methylpropanoate |
| InChIKey | BUTUNJHEBGRWGK-QZTJIDSGSA-N |
| SMILES | CC(C)C(=O)O[C@H]1[C@H](C(OC2=C1C3=C(C=C2)C=CC(=O)O3)(C)C)OC(=O)C |
Computed by PubChem (NCBI)