Products 773873-65-7

CAS 773873-65-7 is the registry number for Methyl 5-bromo-2-ethoxybenzoate, 96%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

Methyl 5-bromo-2-ethoxybenzoate (CAS 773873-65-7) is a chemical compound with the molecular formula C10H11BrO3 and a molecular weight of 259.10 g/mol. IUPAC name: methyl 5-bromo-2-ethoxybenzoate. InChIKey: KBGPOLKFTBVLCH-UHFFFAOYSA-N.

Identity
Molecular formulaC10H11BrO3
Molecular weight259.10 g/mol
IUPAC namemethyl 5-bromo-2-ethoxybenzoate
InChIKeyKBGPOLKFTBVLCH-UHFFFAOYSA-N
SMILESCCOC1=C(C=C(C=C1)Br)C(=O)OC

Computed by PubChem (NCBI)