Products 774227-01-9
CAS 774227-01-9 is the registry number for 1-(4-Aminobenzyl)guanidine Hydrochloride, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g.
2-[(4-aminophenyl)methyl]guanidine;hydrochloride (CAS 774227-01-9) is a chemical compound with the molecular formula C8H13ClN4 and a molecular weight of 200.67 g/mol. IUPAC name: 2-[(4-aminophenyl)methyl]guanidine;hydrochloride. InChIKey: IAFKECDPGDQOFM-UHFFFAOYSA-N.
| Molecular formula | C8H13ClN4 |
|---|---|
| Molecular weight | 200.67 g/mol |
| IUPAC name | 2-[(4-aminophenyl)methyl]guanidine;hydrochloride |
| InChIKey | IAFKECDPGDQOFM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CN=C(N)N)N.Cl |
Computed by PubChem (NCBI)