Products 774239-52-0

CAS 774239-52-0 is the registry number for 1-(tert-Butoxycarbonyl)-1H-imidazole-5-carboxylic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-[(2-methylpropan-2-yl)oxycarbonyl]imidazole-4-carboxylic acid (CAS 774239-52-0) is a chemical compound with the molecular formula C9H12N2O4 and a molecular weight of 212.20 g/mol. IUPAC name: 3-[(2-methylpropan-2-yl)oxycarbonyl]imidazole-4-carboxylic acid. InChIKey: VQMXTGKKHQWWFW-UHFFFAOYSA-N.

Identity
Molecular formulaC9H12N2O4
Molecular weight212.20 g/mol
IUPAC name3-[(2-methylpropan-2-yl)oxycarbonyl]imidazole-4-carboxylic acid
InChIKeyVQMXTGKKHQWWFW-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1C=NC=C1C(=O)O

Computed by PubChem (NCBI)