CAS 77479-01-7 appears in our catalog under these names: Dimethyl 3,3'-(pyrazine-2,5-diyl)dipropanoate, 95%, Methylaminolevulinate EP Impurity C, 2,5-Pyrazinedipropanoic Acid Dimethyl Ester, >95% (HPLC), Dimethyl 3,3'-(pyrazine-2,5-diyl)dipropanoate 95%, Dimethyl 3,3'-(pyrazine-2,5-diyl)dipropanoate, 95%, 95%. Offered by: Combi-blocks, Chemat Brand, TRC, Ambeed, Chemat. Available pack sizes: 100mg, on request, 10mg, 250mg, 50mg, 1g.
Methyl 3-[5-(3-methoxy-3-oxopropyl)pyrazin-2-yl]propanoate (CAS 77479-01-7) is a chemical compound with the molecular formula C12H16N2O4 and a molecular weight of 252.27 g/mol. IUPAC name: methyl 3-[5-(3-methoxy-3-oxopropyl)pyrazin-2-yl]propanoate. InChIKey: CAVDNRICPLKYEH-UHFFFAOYSA-N.
| Molecular formula | C12H16N2O4 |
|---|---|
| Molecular weight | 252.27 g/mol |
| IUPAC name | methyl 3-[5-(3-methoxy-3-oxopropyl)pyrazin-2-yl]propanoate |
| InChIKey | CAVDNRICPLKYEH-UHFFFAOYSA-N |
| SMILES | COC(=O)CCC1=CN=C(C=N1)CCC(=O)OC |
Computed by PubChem (NCBI)