CAS 77519-55-2 appears in our catalog under these names: 2-Oxo-4-phenylpyrrolidine-3-carboxylic acid, 95%, 2-Oxo-4-phenylpyrrolidine-3-carboxylic acid, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 250mg.
2-oxo-4-phenylpyrrolidine-3-carboxylic acid (CAS 77519-55-2) is a chemical compound with the molecular formula C11H11NO3 and a molecular weight of 205.21 g/mol. IUPAC name: 2-oxo-4-phenylpyrrolidine-3-carboxylic acid. InChIKey: UOQRZCNCICUPJO-UHFFFAOYSA-N.
| Molecular formula | C11H11NO3 |
|---|---|
| Molecular weight | 205.21 g/mol |
| IUPAC name | 2-oxo-4-phenylpyrrolidine-3-carboxylic acid |
| InChIKey | UOQRZCNCICUPJO-UHFFFAOYSA-N |
| SMILES | C1C(C(C(=O)N1)C(=O)O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)