Products 77529-38-5
CAS 77529-38-5 appears in our catalog under these names: 4'-Bromo[1,1'-biphenyl]-4-acetamide, 98%, 98%, 4'-Bromo[1,1'-biphenyl]-4-acetamide, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
2-[4-(4-bromophenyl)phenyl]acetamide (CAS 77529-38-5) is a chemical compound with the molecular formula C14H12BrNO and a molecular weight of 290.15 g/mol. IUPAC name: 2-[4-(4-bromophenyl)phenyl]acetamide. InChIKey: XBODOMUIVYODKG-UHFFFAOYSA-N.
| Molecular formula | C14H12BrNO |
|---|---|
| Molecular weight | 290.15 g/mol |
| IUPAC name | 2-[4-(4-bromophenyl)phenyl]acetamide |
| InChIKey | XBODOMUIVYODKG-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CC(=O)N)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)