Products 775351-90-1
CAS 775351-90-1 is the registry number for Corylifol B. Offered by: Biosynth. Available pack sizes: 10mg, 25mg, 50mg.
(E)-1-[2,4-dihydroxy-3-(3-methylbut-2-enyl)phenyl]-3-(3,4-dihydroxyphenyl)prop-2-en-1-one (CAS 775351-90-1) is a chemical compound with the molecular formula C20H20O5 and a molecular weight of 340.4 g/mol. IUPAC name: (E)-1-[2,4-dihydroxy-3-(3-methylbut-2-enyl)phenyl]-3-(3,4-dihydroxyphenyl)prop-2-en-1-one. InChIKey: ISKWCIVFBIHFTG-XBXARRHUSA-N.
| Molecular formula | C20H20O5 |
|---|---|
| Molecular weight | 340.4 g/mol |
| IUPAC name | (E)-1-[2,4-dihydroxy-3-(3-methylbut-2-enyl)phenyl]-3-(3,4-dihydroxyphenyl)prop-2-en-1-one |
| InChIKey | ISKWCIVFBIHFTG-XBXARRHUSA-N |
| SMILES | CC(=CCC1=C(C=CC(=C1O)C(=O)/C=C/C2=CC(=C(C=C2)O)O)O)C |
Computed by PubChem (NCBI)
Synonyms:
Corylifol B, orb2279499