CAS 775519-63-6 is the registry number for [2-Amino-4-(4-fluorophenyl)-1,3-thiazol-5-yl]acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-[2-amino-4-(4-fluorophenyl)-1,3-thiazol-5-yl]acetic acid (CAS 775519-63-6) is a chemical compound with the molecular formula C11H9FN2O2S and a molecular weight of 252.27 g/mol. IUPAC name: 2-[2-amino-4-(4-fluorophenyl)-1,3-thiazol-5-yl]acetic acid. InChIKey: QHQIVMZJIAKRFD-UHFFFAOYSA-N.
| Molecular formula | C11H9FN2O2S |
|---|---|
| Molecular weight | 252.27 g/mol |
| IUPAC name | 2-[2-amino-4-(4-fluorophenyl)-1,3-thiazol-5-yl]acetic acid |
| InChIKey | QHQIVMZJIAKRFD-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=C(SC(=N2)N)CC(=O)O)F |
Computed by PubChem (NCBI)