Products 851879-33-9

CAS 851879-33-9 is the registry number for ([1-(3-Fluorophenyl)-1h-imidazol-2-yl]thio)acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 100mg, 250mg.

Structural formula: {0} (CAS {1})

2-[1-(3-fluorophenyl)imidazol-2-yl]sulfanylacetic acid (CAS 851879-33-9) is a chemical compound with the molecular formula C11H9FN2O2S and a molecular weight of 252.27 g/mol. IUPAC name: 2-[1-(3-fluorophenyl)imidazol-2-yl]sulfanylacetic acid. InChIKey: YGMHOOWRUWSDAP-UHFFFAOYSA-N.

Identity
Molecular formulaC11H9FN2O2S
Molecular weight252.27 g/mol
IUPAC name2-[1-(3-fluorophenyl)imidazol-2-yl]sulfanylacetic acid
InChIKeyYGMHOOWRUWSDAP-UHFFFAOYSA-N
SMILESC1=CC(=CC(=C1)F)N2C=CN=C2SCC(=O)O

Computed by PubChem (NCBI)